EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17O3S |
| Net Charge | -1 |
| Average Mass | 277.365 |
| Monoisotopic Mass | 277.09039 |
| SMILES | CCc1cc(S(=O)(=O)[O-])c2cc(C(C)C)cccc1-2 |
| InChI | InChI=1S/C15H18O3S/c1-4-11-9-15(19(16,17)18)14-8-12(10(2)3)6-5-7-13(11)14/h5-10H,4H2,1-3H3,(H,16,17,18)/p-1 |
| InChIKey | NARQSHREEUXZBT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egualen(1−) (CHEBI:85546) is a arenesulfonate oxoanion (CHEBI:22713) |
| egualen(1−) (CHEBI:85546) is conjugate base of egualen (CHEBI:85542) |
| Incoming Relation(s) |
| egualen sodium (CHEBI:32137) has part egualen(1−) (CHEBI:85546) |
| egualen (CHEBI:85542) is conjugate acid of egualen(1−) (CHEBI:85546) |
| IUPAC Name |
|---|
| 3-ethyl-7-(propan-2-yl)azulene-1-sulfonate |
| Synonym | Source |
|---|---|
| egualen anion | ChEBI |