EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17O3S.Na |
| Net Charge | 0 |
| Average Mass | 300.355 |
| Monoisotopic Mass | 300.07961 |
| SMILES | CCc1cc(S(=O)(=O)[O-])c2cc(C(C)C)cccc1-2.[Na+] |
| InChI | InChI=1S/C15H18O3S.Na/c1-4-11-9-15(19(16,17)18)14-8-12(10(2)3)6-5-7-13(11)14;/h5-10H,4H2,1-3H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | KXGWXVVNYQOMQZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | thromboxane A2 antagonist An antagonist that binds to and deactivates thromboxane A2 receptors. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egualen sodium (CHEBI:32137) has part egualen(1−) (CHEBI:85546) |
| egualen sodium (CHEBI:32137) has role anti-ulcer drug (CHEBI:49201) |
| egualen sodium (CHEBI:32137) has role thromboxane A2 antagonist (CHEBI:85540) |
| egualen sodium (CHEBI:32137) is a organic sodium salt (CHEBI:38700) |
| egualen sodium (CHEBI:32137) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| sodium 3-ethyl-7-(propan-2-yl)azulene-1-sulfonate |
| Synonyms | Source |
|---|---|
| 3-Ethyl-7-(1-methylethyl)-1-azulenesulfonic acid sodium salt | ChemIDplus |
| KT 1-32 | ChemIDplus |
| Azuletil sodium | ChemIDplus |
| sodium 3-ethyl-7-isopropylazulene-1-sulfonate | ChEBI |
| 3-ethyl-7-isopropylazulene sodium sulfonate | ChEBI |
| KT1-32 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C13414 | KEGG COMPOUND |
| KR20100053449 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4897254 | Reaxys |
| CAS:97683-31-3 | KEGG COMPOUND |
| CAS:97683-31-3 | ChemIDplus |
| Citations |
|---|