EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3S |
| Net Charge | 0 |
| Average Mass | 278.373 |
| Monoisotopic Mass | 278.09767 |
| SMILES | CCc1cc(S(=O)(=O)O)c2cc(C(C)C)cccc1-2 |
| InChI | InChI=1S/C15H18O3S/c1-4-11-9-15(19(16,17)18)14-8-12(10(2)3)6-5-7-13(11)14/h5-10H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | NARQSHREEUXZBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | thromboxane A2 antagonist An antagonist that binds to and deactivates thromboxane A2 receptors. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egualen (CHEBI:85542) has role anti-ulcer drug (CHEBI:49201) |
| egualen (CHEBI:85542) has role thromboxane A2 antagonist (CHEBI:85540) |
| egualen (CHEBI:85542) is a arenesulfonic acid (CHEBI:33555) |
| egualen (CHEBI:85542) is a azulenes (CHEBI:38096) |
| egualen (CHEBI:85542) is conjugate acid of egualen(1−) (CHEBI:85546) |
| Incoming Relation(s) |
| egualen(1−) (CHEBI:85546) is conjugate base of egualen (CHEBI:85542) |
| IUPAC Name |
|---|
| 3-ethyl-7-(propan-2-yl)azulene-1-sulfonic acid |
| INNs | Source |
|---|---|
| egualenum | ChemIDplus |
| egualeno | ChemIDplus |
| egualene | ChemIDplus |
| egualen | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-ethyl-7-isopropylazulene-1-sulfonic acid | ChEBI |
| 3-Ethyl-7-isopropyl-1-azulenesulfonic acid | ChemIDplus |
| Azuletil | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 993 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13495833 | Reaxys |
| CAS:99287-30-6 | ChemIDplus |
| Citations |
|---|