EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC[C@@H](C)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m1/s1 |
| InChIKey | AGPKZVBTJJNPAG-UHNVWZDZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alloisoleucine zwitterion (CHEBI:85338) is a amino-acid zwitterion (CHEBI:35238) |
| L-alloisoleucine zwitterion (CHEBI:85338) is enantiomer of D-alloisoleucine zwitterion (CHEBI:85306) |
| L-alloisoleucine zwitterion (CHEBI:85338) is tautomer of L-alloisoleucine (CHEBI:43433) |
| Incoming Relation(s) |
| D-alloisoleucine zwitterion (CHEBI:85306) is enantiomer of L-alloisoleucine zwitterion (CHEBI:85338) |
| L-alloisoleucine (CHEBI:43433) is tautomer of L-alloisoleucine zwitterion (CHEBI:85338) |
| IUPAC Name |
|---|
| (2S,3R)-2-azaniumyl-3-methylpentanoate |
| UniProt Name | Source |
|---|---|
| L-alloisoleucine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16506 | MetaCyc |