EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC[C@H](C)[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m0/s1 |
| InChIKey | AGPKZVBTJJNPAG-CRCLSJGQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-alloisoleucine zwitterion (CHEBI:85306) is a D-α-amino acid zwitterion (CHEBI:59871) |
| D-alloisoleucine zwitterion (CHEBI:85306) is enantiomer of L-alloisoleucine zwitterion (CHEBI:85338) |
| D-alloisoleucine zwitterion (CHEBI:85306) is tautomer of D-alloisoleucine (CHEBI:20899) |
| Incoming Relation(s) |
| L-alloisoleucine zwitterion (CHEBI:85338) is enantiomer of D-alloisoleucine zwitterion (CHEBI:85306) |
| D-alloisoleucine (CHEBI:20899) is tautomer of D-alloisoleucine zwitterion (CHEBI:85306) |
| IUPAC Name |
|---|
| (2R,3S)-2-azaniumyl-3-methylpentanoate |
| UniProt Name | Source |
|---|---|
| D-allo-isoleucine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17659 | MetaCyc |
| Citations |
|---|