EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5+/m1/s1 |
| InChIKey | AGPKZVBTJJNPAG-UHNVWZDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10508118) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alloisoleucine (CHEBI:43433) has role human metabolite (CHEBI:77746) |
| L-alloisoleucine (CHEBI:43433) is a alloisoleucine (CHEBI:22359) |
| L-alloisoleucine (CHEBI:43433) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-alloisoleucine (CHEBI:43433) is enantiomer of D-alloisoleucine (CHEBI:20899) |
| L-alloisoleucine (CHEBI:43433) is tautomer of L-alloisoleucine zwitterion (CHEBI:85338) |
| Incoming Relation(s) |
| D-alloisoleucine (CHEBI:20899) is enantiomer of L-alloisoleucine (CHEBI:43433) |
| L-alloisoleucine residue (CHEBI:30008) is substituent group from L-alloisoleucine (CHEBI:43433) |
| L-alloisoleucine zwitterion (CHEBI:85338) is tautomer of L-alloisoleucine (CHEBI:43433) |
| IUPAC Name |
|---|
| L-alloisoleucine |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-amino-3-methylpentanoic acid | IUPAC |
| allo-L-isoleucine | ChemIDplus |
| L(+)-Alloisoleucine | HMDB |
| threo-L-Isoleucine | HMDB |
| threo-3-methyl-L-Norvaline | HMDB |
| alle | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| IIL | PDBeChem |
| HMDB0000557 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1721791 | Beilstein |
| Reaxys:1721791 | Reaxys |
| CAS:1509-34-8 | ChemIDplus |
| Citations |
|---|