EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:85208 - 12-hydroxyoctadecanoic acid
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | CCCCCCC(O)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21) |
| InChIKey | ULQISTXYYBZJSJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus cereus (ncbitaxon:1396) | - | DOI (10.1007/s11746-997-0188-8) | Strain: 50 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-hydroxyoctadecanoic acid (CHEBI:85208) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 12-hydroxyoctadecanoic acid (CHEBI:85208) has role plant metabolite (CHEBI:76924) |
| 12-hydroxyoctadecanoic acid (CHEBI:85208) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 12-hydroxyoctadecanoic acid (CHEBI:85208) is a secondary alcohol (CHEBI:35681) |
| 12-hydroxyoctadecanoic acid (CHEBI:85208) is conjugate acid of 12-hydroxyoctadecanoate (CHEBI:84201) |
| Incoming Relation(s) |
| 12-[(9Z)-hexadecenoyloxy]octadecanoic acid (CHEBI:137085) has functional parent 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| 12-[(9Z)-octadecenoyloxy]octadecanoic acid (CHEBI:137082) has functional parent 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| 12-hydroxyoctadecanoyl-CoA (CHEBI:85209) has functional parent 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) is a 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| 12-hydroxyoctadecanoate (CHEBI:84201) is conjugate base of 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| IUPAC Name |
|---|
| 12-hydroxyoctadecanoic acid |
| Synonyms | Source |
|---|---|
| 12-hydroxystearic acid | ChEBI |
| 12-hydroxy-octadecanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000130 | LIPID MAPS |
| HMDB0061706 | HMDB |
| Citations |
|---|