EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35O3 |
| Net Charge | -1 |
| Average Mass | 299.475 |
| Monoisotopic Mass | 299.25917 |
| SMILES | CCCCCCC(O)CCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/p-1 |
| InChIKey | ULQISTXYYBZJSJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-hydroxyoctadecanoate (CHEBI:84201) is a hydroxy saturated fatty acid anion (CHEBI:131872) |
| 12-hydroxyoctadecanoate (CHEBI:84201) is a long-chain fatty acid anion (CHEBI:57560) |
| 12-hydroxyoctadecanoate (CHEBI:84201) is conjugate base of 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| Incoming Relation(s) |
| 12-hydroxyoctadecanoic acid (CHEBI:85208) is conjugate acid of 12-hydroxyoctadecanoate (CHEBI:84201) |
| IUPAC Name |
|---|
| 12-hydroxyoctadecanoate |
| Synonyms | Source |
|---|---|
| 12-hydroxyoctadecanoic acid anion | ChEBI |
| 12-hydroxystearate | SUBMITTER |
| 12-hydroxystearic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 12-hydroxyoctadecanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6273653 | Reaxys |
| Citations |
|---|