EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H70O4 |
| Net Charge | 0 |
| Average Mass | 566.952 |
| Monoisotopic Mass | 566.52741 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC(CCCCCC)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C36H70O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-22-25-29-33-36(39)40-34(30-26-8-6-4-2)31-27-23-20-18-19-21-24-28-32-35(37)38/h34H,3-33H2,1-2H3,(H,37,38) |
| InChIKey | HCUIHIKPUYHKSQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) has functional parent octadecanoic acid (CHEBI:28842) |
| 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) is a 12-hydroxyoctadecanoic acid (CHEBI:85208) |
| 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) is a fatty acid ester (CHEBI:35748) |
| 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) is a monocarboxylic acid (CHEBI:25384) |
| 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) is conjugate acid of 12-(octadecanoyloxy)octadecanoate (CHEBI:136330) |
| Incoming Relation(s) |
| 12-(octadecanoyloxy)octadecanoate (CHEBI:136330) is conjugate base of 12-(octadecanoyloxy)octadecanoic acid (CHEBI:137089) |
| IUPAC Name |
|---|
| 12-(octadecanoyloxy)octadecanoic acid |
| Synonyms | Source |
|---|---|
| 12-(stearoyloxy)stearic acid | ChEBI |
| 12-SAHSA | LIPID MAPS |
| 12-octadecanoyloxy-octadecanoic acid | LIPID MAPS |
| FAHFA(18:0/12-O-18:0) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA07011048 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:17355737 | Reaxys |