EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O5S.Na |
| Net Charge | 0 |
| Average Mass | 322.278 |
| Monoisotopic Mass | 322.03478 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)[O-])[C@](C)(Cn1ccnn1)S2(=O)=O.[Na+] |
| InChI | InChI=1S/C10H12N4O5S.Na/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19;/h2-3,7-8H,4-5H2,1H3,(H,16,17);/q;+1/p-1/t7-,8+,10+;/m1./s1 |
| InChIKey | RFMIKMMOLPNEDG-QVUDESDKSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tazobactam sodium (CHEBI:85192) has part tazobactam(1−) (CHEBI:85193) |
| tazobactam sodium (CHEBI:85192) has role antiinfective agent (CHEBI:35441) |
| tazobactam sodium (CHEBI:85192) has role antimicrobial agent (CHEBI:33281) |
| tazobactam sodium (CHEBI:85192) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| tazobactam sodium (CHEBI:85192) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| Zerbaxa (CHEBI:85191) has part tazobactam sodium (CHEBI:85192) |
| IUPAC Name |
|---|
| sodium (2S,3S,5R)-3-methyl-4,4,7-trioxo-3-[(1H-1,2,3-triazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Synonyms | Source |
|---|---|
| Tazobactam sodium salt | ChemIDplus |
| CL 307,579 | ChemIDplus |
| CL 307579 | ChemIDplus |
| 2-alpha-Methyl-2-beta-(1,2,3-triazol-1-ylmethyl)penam-3-alpha-carboxylic acid sodium salt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03707 | KEGG DRUG |
| Tazobactam | Wikipedia |
| DB01606 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6039128 | Reaxys |
| CAS:89785-84-2 | KEGG DRUG |
| CAS:89785-84-2 | ChemIDplus |
| Citations |
|---|