EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OO2)OO |
| InChI | InChI=1S/C20H32O6/c1-2-3-6-9-15(24-23)12-13-17-16(18-14-19(17)26-25-18)10-7-4-5-8-11-20(21)22/h4,7,12-13,15-19,23H,2-3,5-6,8-11,14H2,1H3,(H,21,22)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | SGUKUZOVHSFKPH-YNNPMVKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin G2 (CHEBI:27647) has role human metabolite (CHEBI:77746) |
| prostaglandin G2 (CHEBI:27647) has role mouse metabolite (CHEBI:75771) |
| prostaglandin G2 (CHEBI:27647) is a prostaglandins G (CHEBI:26343) |
| prostaglandin G2 (CHEBI:27647) is conjugate acid of prostaglandin G2(1−) (CHEBI:82629) |
| Incoming Relation(s) |
| 2-[(9S,11R)-epidioxy-(15S)-hydroperoxy-(5Z,13E)-prostadienoyl]-sn-glycero-3- phosphocholine (CHEBI:138100) has functional parent prostaglandin G2 (CHEBI:27647) |
| 2-[(9S,11R)-epidioxy-(15S)-hydroperoxy-(5Z,13E)-prostadienoyl]-sn-glycero-3-phosphoethanolamine (CHEBI:138744) has functional parent prostaglandin G2 (CHEBI:27647) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) has functional parent prostaglandin G2 (CHEBI:27647) |
| prostaglandin G2(1−) (CHEBI:82629) is conjugate base of prostaglandin G2 (CHEBI:27647) |
| IUPAC Names |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroperoxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}hept-5-enoic acid |
| (5Z,9S,11R,13E,15S)-15-hydroperoxy-9,11-epidioxyprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| PGG2 | KEGG COMPOUND |
| Prostaglandin G2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05956 | KEGG COMPOUND |
| DB03866 | DrugBank |
| LMFA03010009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:51982-36-6 | ChemIDplus |
| CAS:51982-36-6 | KEGG COMPOUND |