EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O8 |
| Net Charge | 0 |
| Average Mass | 442.549 |
| Monoisotopic Mass | 442.25667 |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC(CO)CO)[C@@H]2C[C@H]1OO2)OO |
| InChI | InChI=1S/C23H38O8/c1-2-3-6-9-17(29-27)12-13-20-19(21-14-22(20)31-30-21)10-7-4-5-8-11-23(26)28-18(15-24)16-25/h4,7,12-13,17-22,24-25,27H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | CSMKZOGJSGGURC-PKBBWAGBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (22942274) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) has functional parent prostaglandin G2 (CHEBI:27647) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) has role human metabolite (CHEBI:77746) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) is a 2-monoglyceride (CHEBI:17389) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) is a bridged compound (CHEBI:35990) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) is a hydroperoxy fatty ester (CHEBI:145037) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) is a olefinic compound (CHEBI:78840) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) is a organic peroxide (CHEBI:25702) |
| prostaglandin G2 2-glyceryl ester (CHEBI:85165) is a prostaglandins G (CHEBI:26343) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroperoxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}hept-5-enoate |
| Synonym | Source |
|---|---|
| 1,3-dihydroxypropan-2-yl (5Z,9S,11R,13E,15S)-15-hydroperoxy-9,11-epidioxyprosta-5,13-dien-1-oate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-glyceryl-prostaglandin G2 | UniProt |
| Citations |
|---|