EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O6 |
| Net Charge | -1 |
| Average Mass | 367.462 |
| Monoisotopic Mass | 367.21261 |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H]2C[C@H]1OO2)OO |
| InChI | InChI=1S/C20H32O6/c1-2-3-6-9-15(24-23)12-13-17-16(18-14-19(17)26-25-18)10-7-4-5-8-11-20(21)22/h4,7,12-13,15-19,23H,2-3,5-6,8-11,14H2,1H3,(H,21,22)/p-1/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | SGUKUZOVHSFKPH-YNNPMVKQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin G2(1−) (CHEBI:82629) is a oxylipin anion (CHEBI:62933) |
| prostaglandin G2(1−) (CHEBI:82629) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin G2(1−) (CHEBI:82629) is conjugate base of prostaglandin G2 (CHEBI:27647) |
| Incoming Relation(s) |
| prostaglandin G2 (CHEBI:27647) is conjugate acid of prostaglandin G2(1−) (CHEBI:82629) |
| IUPAC Names |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3-hydroperoxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}hept-5-enoate |
| (5Z,9S,11R,13E,15S)-15-hydroperoxy-9,11-epidioxyprosta-5,13-dien-1-oate |
| UniProt Name | Source |
|---|---|
| prostaglandin G2 | UniProt |
| Citations |
|---|