EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H33N5O4 |
| Net Charge | 0 |
| Average Mass | 539.636 |
| Monoisotopic Mass | 539.25325 |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)/C2=C(\Nc1ccc(N(C)C(=O)CN2CCN(C)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H33N5O4/c1-34-15-17-36(18-16-34)20-27(37)35(2)24-12-10-23(11-13-24)32-29(21-7-5-4-6-8-21)28-25-14-9-22(31(39)40-3)19-26(25)33-30(28)38/h4-14,19,32H,15-18,20H2,1-3H3,(H,33,38)/b29-28- |
| InChIKey | XZXHXSATPCNXJR-ZIADKAODSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nintedanib (CHEBI:85164) has role angiogenesis inhibitor (CHEBI:48422) |
| nintedanib (CHEBI:85164) has role antifibrotic agent (CHEBI:233423) |
| nintedanib (CHEBI:85164) has role antineoplastic agent (CHEBI:35610) |
| nintedanib (CHEBI:85164) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| nintedanib (CHEBI:85164) has role tyrosine kinase inhibitor (CHEBI:38637) |
| nintedanib (CHEBI:85164) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| nintedanib (CHEBI:85164) is a N-alkylpiperazine (CHEBI:46845) |
| nintedanib (CHEBI:85164) is a aromatic amide (CHEBI:62733) |
| nintedanib (CHEBI:85164) is a aromatic amine (CHEBI:33860) |
| nintedanib (CHEBI:85164) is a aromatic ester (CHEBI:62732) |
| nintedanib (CHEBI:85164) is a enamine (CHEBI:47989) |
| nintedanib (CHEBI:85164) is a methyl ester (CHEBI:25248) |
| nintedanib (CHEBI:85164) is a oxindoles (CHEBI:38459) |
| nintedanib (CHEBI:85164) is conjugate base of nintedanib(1+) (CHEBI:85172) |
| Incoming Relation(s) |
| nintedanib(1+) (CHEBI:85172) is conjugate acid of nintedanib (CHEBI:85164) |
| IUPAC Name |
|---|
| methyl (3Z)-3-[(4-{methyl[(4-methylpiperazin-1-yl)acetyl]amino}anilino)(phenyl)methylidene]-2-oxo-2,3-dihydro-1H-indole-6-carboxylate |
| INN | Source |
|---|---|
| nintedanib | KEGG DRUG |
| Synonyms | Source |
|---|---|
| BIBF1120 | ChemIDplus |
| BIBF-1120 | ChemIDplus |
| BIBF 1120 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10481 | KEGG DRUG |
| XIN | PDBeChem |
| Nintedanib | Wikipedia |
| 4903 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12016593 | Reaxys |
| CAS:656247-17-5 | KEGG DRUG |
| CAS:656247-17-5 | ChemIDplus |
| Citations |
|---|