EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C31H33N5O4 |
| Net Charge | +1 |
| Average Mass | 540.644 |
| Monoisotopic Mass | 540.26053 |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)/C2=C(\Nc1ccc(N(C)C(=O)CN2CCN(C)CC2)cc1)c1ccccc1.[H+] |
| InChI | InChI=1S/C31H33N5O4/c1-34-15-17-36(18-16-34)20-27(37)35(2)24-12-10-23(11-13-24)32-29(21-7-5-4-6-8-21)28-25-14-9-22(31(39)40-3)19-26(25)33-30(28)38/h4-14,19,32H,15-18,20H2,1-3H3,(H,33,38)/p+1/b29-28- |
| InChIKey | XZXHXSATPCNXJR-ZIADKAODSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nintedanib(1+) (CHEBI:85172) is a organic cation (CHEBI:25697) |
| nintedanib(1+) (CHEBI:85172) is conjugate acid of nintedanib (CHEBI:85164) |
| Incoming Relation(s) |
| nintedanib esylate (CHEBI:85170) has part nintedanib(1+) (CHEBI:85172) |
| nintedanib (CHEBI:85164) is conjugate base of nintedanib(1+) (CHEBI:85172) |
| Synonym | Source |
|---|---|
| nintedanib cation | ChEBI |