EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O8P2 |
| Net Charge | 0 |
| Average Mass | 398.329 |
| Monoisotopic Mass | 398.12594 |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O)CO |
| InChI | InChI=1S/C15H28O8P2/c1-13(7-5-9-15(3)12-16)6-4-8-14(2)10-11-22-25(20,21)23-24(17,18)19/h6,9-10,16H,4-5,7-8,11-12H2,1-3H3,(H,20,21)(H2,17,18,19)/b13-6+,14-10+,15-9+ |
| InChIKey | SYIRLGLBHJFFBK-RDUMTQBOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) has functional parent 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) is a olefinic compound (CHEBI:78840) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) is a polyprenyl diphosphate (CHEBI:37531) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) is a primary alcohol (CHEBI:15734) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) is a terpenyl phosphate (CHEBI:26875) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) is conjugate acid of (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate(3−) (CHEBI:83958) |
| Incoming Relation(s) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate(3−) (CHEBI:83958) is conjugate base of (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) |
| IUPAC Name |
|---|
| (2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 12-hydroxyfarnesyl diphosphate | ChEBI |
| 12-hydroxyfarnesyl pyrophosphate | ChEBI |
| (2E,6E,10E)-12-hydroxyfarnesyl diphosphate | ChEBI |
| (2E,6E,10E)-12-hydroxyfarnesyl pyrophosphate | ChEBI |
| (2E,6E,10E)-ω-hydroxyfarnesyl pyrophosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11108289 | Reaxys |
| Citations |
|---|