EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25O8P2 |
| Net Charge | -3 |
| Average Mass | 395.305 |
| Monoisotopic Mass | 395.10411 |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-])CO |
| InChI | InChI=1S/C15H28O8P2/c1-13(7-5-9-15(3)12-16)6-4-8-14(2)10-11-22-25(20,21)23-24(17,18)19/h6,9-10,16H,4-5,7-8,11-12H2,1-3H3,(H,20,21)(H2,17,18,19)/p-3/b13-6+,14-10+,15-9+ |
| InChIKey | SYIRLGLBHJFFBK-RDUMTQBOSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate(3−) (CHEBI:83958) is a organophosphate oxoanion (CHEBI:58945) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate(3−) (CHEBI:83958) is conjugate base of (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) |
| Incoming Relation(s) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) is conjugate acid of (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate(3−) (CHEBI:83958) |
| Synonyms | Source |
|---|---|
| (2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl diphosphate(3−) | SUBMITTER |
| 12-hydroxyfarnesyl diphosphate(3−) | ChEBI |
| (2E,6E,10E)-12-hydroxyfarnesyl diphosphate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E,6E)-ω-hydroxy-farnesyl diphosphate | UniProt |
| Citations |
|---|