EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O7P2 |
| Net Charge | 0 |
| Average Mass | 382.330 |
| Monoisotopic Mass | 382.13103 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+,15-11+ |
| InChIKey | VWFJDQUYCIWHTN-YFVJMOTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) has role Escherichia coli metabolite (CHEBI:76971) |
| 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) has role mouse metabolite (CHEBI:75771) |
| 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) is a farnesyl diphosphate (CHEBI:50277) |
| 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) is conjugate acid of 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) |
| Incoming Relation(s) |
| (2E,6E,10E)-ω-hydroxyfarnesyl diphosphate (CHEBI:84985) has functional parent 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) |
| 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) is conjugate base of 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) |
| IUPAC Name |
|---|
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| (2E,6E)-Farnesyl diphosphate | KEGG COMPOUND |
| (2E,6E)-farnesol diphosphate | ChEBI |
| (2E,6E)-farnesyl diphosphate | ChemIDplus |
| (2E,6E)-farnesyl pyrophosphate | ChemIDplus |
| 2-trans,6-trans-farnesyl pyrophosphate | ChemIDplus |
| 2-trans,6-trans-farnesyl diphosphate | ChEBI |
| Citations |
|---|