EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C6H8ClN7O |
| Net Charge | +1 |
| Average Mass | 230.639 |
| Monoisotopic Mass | 230.05516 |
| SMILES | N=C(N)NC(=O)c1nc(Cl)c(N)nc1N.[H+] |
| InChI | InChI=1S/C6H8ClN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15)/p+1 |
| InChIKey | XSDQTOBWRPYKKA-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amiloride(1+) (CHEBI:84745) is a organic cation (CHEBI:25697) |
| amiloride(1+) (CHEBI:84745) is conjugate acid of amiloride (CHEBI:2639) |
| Incoming Relation(s) |
| amiloride hydrochloride (CHEBI:84743) has part amiloride(1+) (CHEBI:84745) |
| amiloride (CHEBI:2639) is conjugate base of amiloride(1+) (CHEBI:84745) |
| Synonym | Source |
|---|---|
| amiloride cation | ChEBI |