EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8ClN7O.HCl |
| Net Charge | 0 |
| Average Mass | 266.092 |
| Monoisotopic Mass | 265.02456 |
| SMILES | Cl.N=C(N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C6H8ClN7O.ClH/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;/h(H4,8,9,13)(H4,10,11,14,15);1H |
| InChIKey | ACHKKGDWZVCSNH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Application: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amiloride hydrochloride (CHEBI:84743) has part amiloride(1+) (CHEBI:84745) |
| amiloride hydrochloride (CHEBI:84743) has role diuretic (CHEBI:35498) |
| amiloride hydrochloride (CHEBI:84743) has role sodium channel blocker (CHEBI:38633) |
| amiloride hydrochloride (CHEBI:84743) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| amiloride hydrochloride dihydrate (CHEBI:2640) has part amiloride hydrochloride (CHEBI:84743) |
| IUPAC Name |
|---|
| 3,5-diamino-N-carbamimidoyl-6-chloropyrazine-2-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| amiloride monohydrochloride | ChEBI |
| N-Amidino-3,5-diamino-6-chloropyrazinecarboxamide monohydrochloride | ChemIDplus |
| Amiloride HCl | ChemIDplus |
| Amiloride hydrochloride anhydrous | ChemIDplus |
| Amiloride chloride | ChemIDplus |
| Citations |
|---|