EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8ClN7O.2H2O.HCl |
| Net Charge | 0 |
| Average Mass | 302.122 |
| Monoisotopic Mass | 301.04569 |
| SMILES | Cl.N=C(N)NC(=O)c1nc(Cl)c(N)nc1N.O.O |
| InChI | InChI=1S/C6H8ClN7O.ClH.2H2O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;;;/h(H4,8,9,13)(H4,10,11,14,15);1H;2*1H2 |
| InChIKey | LTKVFMLMEYCWMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Application: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amiloride hydrochloride dihydrate (CHEBI:2640) has part amiloride hydrochloride (CHEBI:84743) |
| amiloride hydrochloride dihydrate (CHEBI:2640) has role diuretic (CHEBI:35498) |
| amiloride hydrochloride dihydrate (CHEBI:2640) has role sodium channel blocker (CHEBI:38633) |
| amiloride hydrochloride dihydrate (CHEBI:2640) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| N-amidino-3,5-diamino-6-chloropyrazinecarboxamide hydrochloride dihydrate |
| INN | Source |
|---|---|
| Modamide | ChemIDplus |
| Synonym | Source |
|---|---|
| Amilorid hydrochlorid-2-wasser | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13319490 | Reaxys |
| CAS:17440-83-4 | ChemIDplus |