EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38O16 |
| Net Charge | 0 |
| Average Mass | 702.662 |
| Monoisotopic Mass | 702.21599 |
| SMILES | COc1cc2c(O[C@@H]3O[C@H](CO)[C@@H](O[C@@H]4OC[C@@H](O)[C@H](OC)[C@H]4OC)[C@H](O)[C@H]3O)c3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)C(=O)OC3 |
| InChI | InChI=1S/C34H38O16/c1-40-20-8-15-16(9-21(20)41-2)28(17-11-44-32(39)25(17)24(15)14-5-6-19-22(7-14)47-13-46-19)49-33-27(38)26(37)30(23(10-35)48-33)50-34-31(43-4)29(42-3)18(36)12-45-34/h5-9,18,23,26-27,29-31,33-38H,10-13H2,1-4H3/t18-,23-,26-,27-,29+,30-,31-,33+,34+/m1/s1 |
| InChIKey | SOUKMFVXMWFSFB-ZQJLHNCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistanthus collinus (ncbitaxon:1357584) | aerial part (BTO:0001658) | PubMed (14600376) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cleistanthin C (CHEBI:84408) has functional parent cleistanthin B (CHEBI:84407) |
| cleistanthin C (CHEBI:84408) is a cleistanthins (CHEBI:84406) |
| cleistanthin C (CHEBI:84408) is a disaccharide derivative (CHEBI:63353) |
| Incoming Relation(s) |
| cleistanthin E (CHEBI:84416) has functional parent cleistanthin C (CHEBI:84408) |
| IUPAC Name |
|---|
| 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-1,3-dihydronaphtho[2,3-c]furan-4-yl 4-O-(2,3-di-O-methyl-β-D-xylopyranosyl)-β-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C00031682 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5214311 | Reaxys |
| CAS:57576-58-6 | KNApSAcK |
| Citations |
|---|