EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H52O20 |
| Net Charge | 0 |
| Average Mass | 876.858 |
| Monoisotopic Mass | 876.30519 |
| SMILES | COC[C@H]1O[C@@H](O[C@@H]2CO[C@@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](Oc4c5c(c(-c6ccc7c(c6)OCO7)c6cc(OC)c(OC)cc46)C(=O)OC5)O[C@@H]3CO)[C@H](OC)[C@H]2OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C42H52O20/c1-47-15-27-35(50-4)38(53-7)42(59-27)60-28-16-55-41(37(52-6)36(28)51-5)62-34-26(13-43)58-40(32(45)31(34)44)61-33-20-12-24(49-3)23(48-2)11-19(20)29(30-21(33)14-54-39(30)46)18-8-9-22-25(10-18)57-17-56-22/h8-12,26-28,31-32,34-38,40-45H,13-17H2,1-7H3/t26-,27-,28-,31-,32-,34-,35+,36+,37-,38-,40+,41+,42+/m1/s1 |
| InChIKey | VBUYDYFOLFVYET-YSGUZRDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistanthus collinus (ncbitaxon:1357584) | heartwood (PO:0004512) | Article (Tetrahedron, 1981, 37, 3641-3652) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cleistanthin E (CHEBI:84416) has functional parent cleistanthin C (CHEBI:84408) |
| cleistanthin E (CHEBI:84416) is a cleistanthins (CHEBI:84406) |
| cleistanthin E (CHEBI:84416) is a trisaccharide derivative (CHEBI:63571) |
| IUPAC Name |
|---|
| 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-1,3-dihydronaphtho[2,3-c]furan-4-yl 2,3,5-tri-O-methyl-β-D-xylofuranosyl-(1→4)-2,3-di-O-methyl-β-D-xylopyranosyl-(1→4)-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5224385 | Reaxys |