EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26O12 |
| Net Charge | 0 |
| Average Mass | 542.493 |
| Monoisotopic Mass | 542.14243 |
| SMILES | COc1cc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)C(=O)OC3 |
| InChI | InChI=1S/C27H26O12/c1-33-16-6-12-13(7-17(16)34-2)25(39-27-24(31)23(30)22(29)19(8-28)38-27)14-9-35-26(32)21(14)20(12)11-3-4-15-18(5-11)37-10-36-15/h3-7,19,22-24,27-31H,8-10H2,1-2H3/t19-,22-,23+,24-,27+/m1/s1 |
| InChIKey | BJGIWVGXMRUMNA-WBYCZGBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistanthus collinus (ncbitaxon:1357584) | aerial part (BTO:0001658) | Article (Tetrahedron, 1981, 37, 3641-3652) |
| Roles Classification |
|---|
| Biological Roles: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. diuretic An agent that promotes the excretion of urine through its effects on kidney function. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cleistanthin B (CHEBI:84407) has role antihypertensive agent (CHEBI:35674) |
| cleistanthin B (CHEBI:84407) has role diuretic (CHEBI:35498) |
| cleistanthin B (CHEBI:84407) has role α-adrenergic antagonist (CHEBI:37890) |
| cleistanthin B (CHEBI:84407) is a cleistanthins (CHEBI:84406) |
| cleistanthin B (CHEBI:84407) is a monosaccharide derivative (CHEBI:63367) |
| cleistanthin B (CHEBI:84407) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| cleistanthin C (CHEBI:84408) has functional parent cleistanthin B (CHEBI:84407) |
| IUPAC Name |
|---|
| 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-1,3-dihydronaphtho[2,3-c]furan-4-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 4-O-(β-D-glucopyranosyl)diphyllin | ChEBI |
| 9-(1,3-benzodioxol-5-yl)-4-(β-D-glucopyranosyloxy)-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one | ChemIDplus |
| Clei B | ChemIDplus |
| diphyllin β-D-glucoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4282920 | Reaxys |
| CAS:30021-77-3 | ChemIDplus |
| Citations |
|---|