EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2S4 |
| Net Charge | 0 |
| Average Mass | 226.417 |
| Monoisotopic Mass | 225.97268 |
| SMILES | CC(CNC(=S)S)NC(=S)S |
| InChI | InChI=1S/C5H10N2S4/c1-3(7-5(10)11)2-6-4(8)9/h3H,2H2,1H3,(H2,6,8,9)(H2,7,10,11) |
| InChIKey | IJIHYLHFNAWUGR-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propylene 1,2-bis(dithiocarbamic acid) (CHEBI:84294) has functional parent propylenediamine (CHEBI:30630) |
| propylene 1,2-bis(dithiocarbamic acid) (CHEBI:84294) is a dithiocarbamic acids (CHEBI:78787) |
| propylene 1,2-bis(dithiocarbamic acid) (CHEBI:84294) is conjugate acid of propylene 1,2-bis(dithiocarbamate) (CHEBI:84295) |
| Incoming Relation(s) |
| propylene 1,2-bis(dithiocarbamate) (CHEBI:84295) is conjugate base of propylene 1,2-bis(dithiocarbamic acid) (CHEBI:84294) |
| IUPAC Name |
|---|
| propane-1,2-diyldicarbamodithioic acid |
| Synonym | Source |
|---|---|
| propylenebis(dithiocarbamic) acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2360676 | Reaxys |
| CAS:35449-52-6 | ChemIDplus |