EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2S4 |
| Net Charge | -2 |
| Average Mass | 224.401 |
| Monoisotopic Mass | 223.95813 |
| SMILES | CC(CNC(=S)[S-])NC(=S)[S-] |
| InChI | InChI=1S/C5H10N2S4/c1-3(7-5(10)11)2-6-4(8)9/h3H,2H2,1H3,(H2,6,8,9)(H2,7,10,11)/p-2 |
| InChIKey | IJIHYLHFNAWUGR-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propylene 1,2-bis(dithiocarbamate) (CHEBI:84295) is a dithiocarbamate anions (CHEBI:84292) |
| propylene 1,2-bis(dithiocarbamate) (CHEBI:84295) is conjugate base of propylene 1,2-bis(dithiocarbamic acid) (CHEBI:84294) |
| Incoming Relation(s) |
| propineb (CHEBI:81755) has part propylene 1,2-bis(dithiocarbamate) (CHEBI:84295) |
| propylene 1,2-bis(dithiocarbamic acid) (CHEBI:84294) is conjugate acid of propylene 1,2-bis(dithiocarbamate) (CHEBI:84295) |