EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2.HCl |
| Net Charge | 0 |
| Average Mass | 314.860 |
| Monoisotopic Mass | 314.15498 |
| SMILES | Cl.[H]/C(CN1CCCC1)=C(/c1ccc(C)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H22N2.ClH/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21;/h2-3,6-12H,4-5,13-15H2,1H3;1H/b18-11+; |
| InChIKey | WYUYEJNGHIOFOC-NWBUNABESA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triprolidine hydrochloride (anh.) (CHEBI:84119) has part triprolidine(1+) (CHEBI:84117) |
| triprolidine hydrochloride (anh.) (CHEBI:84119) has role H1-receptor antagonist (CHEBI:37955) |
| triprolidine hydrochloride (anh.) (CHEBI:84119) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| triprolidine hydrochloride monohydrate (CHEBI:32265) has part triprolidine hydrochloride (anh.) (CHEBI:84119) |
| IUPAC Name |
|---|
| 2-[(1E)-1-(4-methylphenyl)-3-(pyrrolidin-1-yl)prop-1-en-1-yl]pyridine hydrochloride |
| Synonyms | Source |
|---|---|
| 1-[(2E)-3-(4-methylphenyl)-3-(pyridin-2-yl)prop-2-en-1-yl]pyrrolidinium chloride | IUPAC |
| triprolidine hydrochloride (anhydrous) | ChEBI |
| triprolidine hydrochloride anhydrous | ChemIDplus |
| triprolidine monohydrochloride (anh.) | ChEBI |
| triprolidine monohydrochloride (anhydrous) | ChEBI |
| triprolidine monohydrochloride anhydrous | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3743215 | Reaxys |
| CAS:550-70-9 | ChemIDplus |