EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N2 |
| Net Charge | +1 |
| Average Mass | 279.407 |
| Monoisotopic Mass | 279.18558 |
| SMILES | [H]/C(C[NH+]1CCCC1)=C(/c1ccc(C)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/p+1/b18-11+ |
| InChIKey | CBEQULMOCCWAQT-WOJGMQOQSA-O |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triprolidine(1+) (CHEBI:84117) has role H1-receptor antagonist (CHEBI:37955) |
| triprolidine(1+) (CHEBI:84117) is a ammonium ion derivative (CHEBI:35274) |
| triprolidine(1+) (CHEBI:84117) is conjugate acid of triprolidine (CHEBI:84116) |
| Incoming Relation(s) |
| triprolidine hydrochloride (anh.) (CHEBI:84119) has part triprolidine(1+) (CHEBI:84117) |
| triprolidine (CHEBI:84116) is conjugate base of triprolidine(1+) (CHEBI:84117) |
| IUPAC Name |
|---|
| 1-[(2E)-3-(4-methylphenyl)-3-(pyridin-2-yl)prop-2-en-1-yl]pyrrolidinium |