EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2 |
| Net Charge | 0 |
| Average Mass | 278.399 |
| Monoisotopic Mass | 278.17830 |
| SMILES | [H]/C(CN1CCCC1)=C(/c1ccc(C)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+ |
| InChIKey | CBEQULMOCCWAQT-WOJGMQOQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triprolidine (CHEBI:84116) has role H1-receptor antagonist (CHEBI:37955) |
| triprolidine (CHEBI:84116) is a N-alkylpyrrolidine (CHEBI:46775) |
| triprolidine (CHEBI:84116) is a olefinic compound (CHEBI:78840) |
| triprolidine (CHEBI:84116) is a pyridines (CHEBI:26421) |
| triprolidine (CHEBI:84116) is conjugate base of triprolidine(1+) (CHEBI:84117) |
| Incoming Relation(s) |
| triprolidine(1+) (CHEBI:84117) is conjugate acid of triprolidine (CHEBI:84116) |
| IUPAC Name |
|---|
| 2-[(1E)-1-(4-methylphenyl)-3-(pyrrolidin-1-yl)prop-1-en-1-yl]pyridine |
| INNs | Source |
|---|---|
| tripolidina | ChemIDplus |
| triprolidine | WHO MedNet |
| triprolidine | ChemIDplus |
| triprolidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (E)-2-[3-(1-pyrrolidinyl)-1-p-toluenepropenyl]pyridine | NIST Chemistry WebBook |
| trans-1-(2-pyridyl)-3-pyrrolidino-1-p-tolylprop-1-ene | ChemIDplus |
| trans-1-(4-methylphenyl)-1-(2-pyridyl)-3-pyrrolidinoprop-1-ene | ChemIDplus |
| trans-2-(3-(1-pyrrolidinyl)-1-p-tolylpropenyl)pyridine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2763 | DrugCentral |
| D08648 | KEGG DRUG |
| DB00427 | DrugBank |
| HMDB0014571 | HMDB |
| Triprolidine | Wikipedia |
| US2712020 | Patent |
| US2712023 | Patent |
| Citations |
|---|