EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2S4 |
| Net Charge | 0 |
| Average Mass | 212.390 |
| Monoisotopic Mass | 211.95703 |
| SMILES | S=C(S)NCCNC(=S)S |
| InChI | InChI=1S/C4H8N2S4/c7-3(8)5-1-2-6-4(9)10/h1-2H2,(H2,5,7,8)(H2,6,9,10) |
| InChIKey | AWYFNIZYMPNGAI-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenebis(dithiocarbamic acid) (CHEBI:83986) has functional parent ethylenediamine (CHEBI:30347) |
| ethylenebis(dithiocarbamic acid) (CHEBI:83986) is a dithiocarbamic acids (CHEBI:78787) |
| ethylenebis(dithiocarbamic acid) (CHEBI:83986) is conjugate acid of ethylenebis(dithiocarbamate) (CHEBI:77308) |
| Incoming Relation(s) |
| ethylenebis(dithiocarbamate) (CHEBI:77308) is conjugate base of ethylenebis(dithiocarbamic acid) (CHEBI:83986) |
| IUPAC Name |
|---|
| ethane-1,2-diyldicarbamodithioic acid |
| Synonyms | Source |
|---|---|
| ethylenebisdithiocarbamic acid | ChemIDplus |
| N,N'-(ethylene)bisdithiocarbamic acid | ChEBI |
| N,N'-ethanediylbis(dithiocarbamic acid) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1772091 | Reaxys |
| CAS:111-54-6 | ChemIDplus |