EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2S4 |
| Net Charge | -2 |
| Average Mass | 210.374 |
| Monoisotopic Mass | 209.94248 |
| SMILES | S=C([S-])NCCNC(=S)[S-] |
| InChI | InChI=1S/C4H8N2S4/c7-3(8)5-1-2-6-4(9)10/h1-2H2,(H2,5,7,8)(H2,6,9,10)/p-2 |
| InChIKey | AWYFNIZYMPNGAI-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylenebis(dithiocarbamate) (CHEBI:77308) is a dithiocarbamate anions (CHEBI:84292) |
| ethylenebis(dithiocarbamate) (CHEBI:77308) is conjugate base of ethylenebis(dithiocarbamic acid) (CHEBI:83986) |
| Incoming Relation(s) |
| amobam (CHEBI:81754) has part ethylenebis(dithiocarbamate) (CHEBI:77308) |
| nabam (CHEBI:81934) has part ethylenebis(dithiocarbamate) (CHEBI:77308) |
| zineb (CHEBI:52498) has part ethylenebis(dithiocarbamate) (CHEBI:77308) |
| ethylenebis(dithiocarbamic acid) (CHEBI:83986) is conjugate acid of ethylenebis(dithiocarbamate) (CHEBI:77308) |
| IUPAC Name |
|---|
| ethane-1,2-diyldicarbamodithioate |
| Synonym | Source |
|---|---|
| ethylenebis(dithiocarbamic acid)(2−) | ChEBI |