EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39O3 |
| Net Charge | -1 |
| Average Mass | 327.529 |
| Monoisotopic Mass | 327.29047 |
| SMILES | CC(CO)CCCC(C)CCCC(C)CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C20H40O3/c1-16(10-6-12-18(3)14-20(22)23)8-5-9-17(2)11-7-13-19(4)15-21/h16-19,21H,5-15H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | CBZPGRKSSXCZLI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxyphytanate (CHEBI:83916) has functional parent phytanate (CHEBI:37257) |
| ω-hydroxyphytanate (CHEBI:83916) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| ω-hydroxyphytanate (CHEBI:83916) is a hydroxy fatty acid anion (CHEBI:59835) |
| ω-hydroxyphytanate (CHEBI:83916) is a long-chain fatty acid anion (CHEBI:57560) |
| ω-hydroxyphytanate (CHEBI:83916) is a methyl-branched fatty acid anion (CHEBI:67013) |
| ω-hydroxyphytanate (CHEBI:83916) is conjugate base of ω-hydroxyphytanic acid (CHEBI:84925) |
| Incoming Relation(s) |
| ω-hydroxyphytanic acid (CHEBI:84925) is conjugate acid of ω-hydroxyphytanate (CHEBI:83916) |
| IUPAC Name |
|---|
| 16-hydroxy-3,7,11,15-tetramethylhexadecanoate |
| UniProt Name | Source |
|---|---|
| ω-hydroxy-3,7,11,15-tetramethyl-hexadecanoate | UniProt |
| Citations |
|---|