EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84925 - ω-hydroxyphytanic acid
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CC(CO)CCCC(C)CCCC(C)CCCC(C)CC(=O)O |
| InChI | InChI=1S/C20H40O3/c1-16(10-6-12-18(3)14-20(22)23)8-5-9-17(2)11-7-13-19(4)15-21/h16-19,21H,5-15H2,1-4H3,(H,22,23) |
| InChIKey | CBZPGRKSSXCZLI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (15102880) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxyphytanic acid (CHEBI:84925) has functional parent phytanic acid (CHEBI:16285) |
| ω-hydroxyphytanic acid (CHEBI:84925) has parent hydride phytane (CHEBI:48937) |
| ω-hydroxyphytanic acid (CHEBI:84925) has role mammalian metabolite (CHEBI:75768) |
| ω-hydroxyphytanic acid (CHEBI:84925) is a branched-chain saturated fatty acid (CHEBI:39417) |
| ω-hydroxyphytanic acid (CHEBI:84925) is a hydroxy fatty acid (CHEBI:24654) |
| ω-hydroxyphytanic acid (CHEBI:84925) is a long-chain fatty acid (CHEBI:15904) |
| ω-hydroxyphytanic acid (CHEBI:84925) is a methyl-branched fatty acid (CHEBI:62499) |
| ω-hydroxyphytanic acid (CHEBI:84925) is conjugate acid of ω-hydroxyphytanate (CHEBI:83916) |
| Incoming Relation(s) |
| ω-hydroxyphytanate (CHEBI:83916) is conjugate base of ω-hydroxyphytanic acid (CHEBI:84925) |
| IUPAC Name |
|---|
| 16-hydroxy-3,7,11,15-tetramethylhexadecanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11001403 | Reaxys |
| Citations |
|---|