EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39O2 |
| Net Charge | -1 |
| Average Mass | 311.530 |
| Monoisotopic Mass | 311.29555 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h16-19H,6-15H2,1-5H3,(H,21,22)/p-1 |
| InChIKey | RLCKHJSFHOZMDR-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytanate (CHEBI:37257) has functional parent hexadecanoate (CHEBI:7896) |
| phytanate (CHEBI:37257) has functional parent hexadecanoic acid (CHEBI:15756) |
| phytanate (CHEBI:37257) has role human metabolite (CHEBI:77746) |
| phytanate (CHEBI:37257) is a 3-methyl fatty acid anion (CHEBI:83972) |
| phytanate (CHEBI:37257) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| phytanate (CHEBI:37257) is a long-chain fatty acid anion (CHEBI:57560) |
| phytanate (CHEBI:37257) is conjugate base of phytanic acid (CHEBI:16285) |
| Incoming Relation(s) |
| ω-hydroxyphytanate (CHEBI:83916) has functional parent phytanate (CHEBI:37257) |
| phytanic acid (CHEBI:16285) is conjugate acid of phytanate (CHEBI:37257) |
| IUPAC Name |
|---|
| 3,7,11,15-tetramethylhexadecanoate |
| Synonyms | Source |
|---|---|
| 3,7,11,15-tetramethylpalmitate | ChEBI |
| phytanate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,7,11,15-tetramethylhexadecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01607 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3669982 | Reaxys |
| Citations |
|---|