EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6NO3 |
| Net Charge | -1 |
| Average Mass | 164.140 |
| Monoisotopic Mass | 164.03532 |
| SMILES | Nc1ccccc1C(=O)C(=O)[O-] |
| InChI | InChI=1S/C8H7NO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4H,9H2,(H,11,12)/p-1 |
| InChIKey | MQMWPBBDMIYYMI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminophenylglyoxylate (CHEBI:82904) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 2-aminophenylglyoxylate (CHEBI:82904) is conjugate base of 2-aminophenylglyoxylic acid (CHEBI:83716) |
| Incoming Relation(s) |
| 2-aminophenylglyoxylic acid (CHEBI:83716) is conjugate acid of 2-aminophenylglyoxylate (CHEBI:82904) |
| IUPAC Name |
|---|
| (2-aminophenyl)(oxo)acetate |
| Synonyms | Source |
|---|---|
| isatinate | MetaCyc |
| α-aminophenylglyoxylate | MetaCyc |
| o-aminophenylglyoxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| isatinate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| ALPHA-AMINOPHENYL-GLYOXYLATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3608540 | Reaxys |
| Citations |
|---|