EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26N5O9P |
| Net Charge | 0 |
| Average Mass | 451.373 |
| Monoisotopic Mass | 451.14681 |
| SMILES | N=c1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(NCCCC[C@H](N)C(=O)O)n1 |
| InChI | InChI=1S/C15H26N5O9P/c16-8(14(23)24)3-1-2-5-18-15-19-10(17)4-6-20(15)13-12(22)11(21)9(29-13)7-28-30(25,26)27/h4,6,8-9,11-13,21-22H,1-3,5,7,16H2,(H,23,24)(H2,17,18,19)(H2,25,26,27)/t8-,9+,11+,12+,13+/m0/s1 |
| InChIKey | RKOISILXSYNZKS-IINAIABHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysidine monophosphate (CHEBI:83661) has functional parent cytidine 5'-monophosphate (CHEBI:17361) |
| lysidine monophosphate (CHEBI:83661) has functional parent lysidine (CHEBI:64328) |
| lysidine monophosphate (CHEBI:83661) is a L-lysine derivative (CHEBI:25095) |
| lysidine monophosphate (CHEBI:83661) is a cytidines (CHEBI:23524) |
| lysidine monophosphate (CHEBI:83661) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| lysidine monophosphate (CHEBI:83661) is a pyrimidine ribonucleoside 5'-monophosphate (CHEBI:39457) |
| lysidine monophosphate (CHEBI:83661) is conjugate acid of lysidine monophosphate(1−) (CHEBI:83662) |
| Incoming Relation(s) |
| lysidine monophosphate(1−) (CHEBI:83662) is conjugate base of lysidine monophosphate (CHEBI:83661) |
| lysine monophosphate residue (CHEBI:83664) is substituent group from lysidine monophosphate (CHEBI:83661) |
| IUPAC Name |
|---|
| N6-[4-amino-1-(5-O-phosphono-β-D-ribofuranosyl)pyrimidin-2(1H)-ylidene]-L-lysine |
| Synonyms | Source |
|---|---|
| lysidine 5'-monophosphate | ChEBI |
| lysidine 5'-phosphate | ChEBI |