EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N5O6 |
| Net Charge | 0 |
| Average Mass | 371.394 |
| Monoisotopic Mass | 371.18048 |
| SMILES | N=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(NCCCC[C@H](N)C(=O)O)n1 |
| InChI | InChI=1S/C15H25N5O6/c16-8(14(24)25)3-1-2-5-18-15-19-10(17)4-6-20(15)13-12(23)11(22)9(7-21)26-13/h4,6,8-9,11-13,21-23H,1-3,5,7,16H2,(H,24,25)(H2,17,18,19)/t8-,9+,11+,12+,13+/m0/s1 |
| InChIKey | MDWUIKMWKDMPDE-IINAIABHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysidine (CHEBI:64328) is a L-lysine derivative (CHEBI:25095) |
| lysidine (CHEBI:64328) is a cytidines (CHEBI:23524) |
| lysidine (CHEBI:64328) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| lysidine monophosphate (CHEBI:83661) has functional parent lysidine (CHEBI:64328) |
| IUPAC Name |
|---|
| N6-[4-imino-1-(β-D-ribofuranosyl)-1,4-dihydropyrimidin-2-yl]-L-lysine |
| Synonyms | Source |
|---|---|
| 2-lysylcytidine | ChEBI |
| k2C | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Lysidine_(nucleoside) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:144796-96-3 | Wikipedia |
| Citations |
|---|