EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N5O9P |
| Net Charge | -1 |
| Average Mass | 450.365 |
| Monoisotopic Mass | 450.13954 |
| SMILES | N=c1ccn([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c(NCCCC[C@H]([NH3+])C(=O)[O-])[nH+]1 |
| InChI | InChI=1S/C15H26N5O9P/c16-8(14(23)24)3-1-2-5-18-15-19-10(17)4-6-20(15)13-12(22)11(21)9(29-13)7-28-30(25,26)27/h4,6,8-9,11-13,21-22H,1-3,5,7,16H2,(H,23,24)(H2,17,18,19)(H2,25,26,27)/p-1/t8-,9+,11+,12+,13+/m0/s1 |
| InChIKey | RKOISILXSYNZKS-IINAIABHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysidine monophosphate(1−) (CHEBI:83662) is a organophosphate oxoanion (CHEBI:58945) |
| lysidine monophosphate(1−) (CHEBI:83662) is conjugate base of lysidine monophosphate (CHEBI:83661) |
| Incoming Relation(s) |
| lysidine monophosphate (CHEBI:83661) is conjugate acid of lysidine monophosphate(1−) (CHEBI:83662) |
| lysidine monophosphate zwitterion residue (CHEBI:83665) is substituent group from lysidine monophosphate(1−) (CHEBI:83662) |