EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N5O8PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 374.224 |
| Monoisotopic Mass (excl. R groups) | 374.05017 |
| SMILES | *C(=O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fatty acyl-AMP (CHEBI:83621) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| fatty acyl-AMP (CHEBI:83621) has functional parent fatty acid (CHEBI:35366) |
| fatty acyl-AMP (CHEBI:83621) is a adenosine 5'-phosphate (CHEBI:37096) |
| fatty acyl-AMP (CHEBI:83621) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| fatty acyl-AMP (CHEBI:83621) is conjugate acid of fatty acyl-AMP(1−) (CHEBI:83622) |
| Incoming Relation(s) |
| dodecanoyl-AMP (CHEBI:84312) is a fatty acyl-AMP (CHEBI:83621) |
| long-chain fatty acyl-AMP (CHEBI:137376) is a fatty acyl-AMP (CHEBI:83621) |
| fatty acyl-AMP(1−) (CHEBI:83622) is conjugate base of fatty acyl-AMP (CHEBI:83621) |
| Synonyms | Source |
|---|---|
| fatty acyl-adenosine-5-monophosphate | SUBMITTER |
| fatty acyl-adenylate | SUBMITTER |