EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N5O8PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 374.224 |
| Monoisotopic Mass (excl. R groups) | 374.05017 |
| SMILES | *C(=O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| long-chain fatty acyl-AMP (CHEBI:137376) has functional parent long-chain fatty acid (CHEBI:15904) |
| long-chain fatty acyl-AMP (CHEBI:137376) is a fatty acyl-AMP (CHEBI:83621) |
| long-chain fatty acyl-AMP (CHEBI:137376) is conjugate acid of long-chain fatty acyl-AMP(1−) (CHEBI:136562) |
| Incoming Relation(s) |
| hexadecanoyl-AMP (CHEBI:84414) is a long-chain fatty acyl-AMP (CHEBI:137376) |
| tetradecanoyl-AMP (CHEBI:84412) is a long-chain fatty acyl-AMP (CHEBI:137376) |
| long-chain fatty acyl-AMP(1−) (CHEBI:136562) is conjugate base of long-chain fatty acyl-AMP (CHEBI:137376) |
| Synonyms | Source |
|---|---|
| long-chain fatty acyl-adenosine-5-monophosphate | ChEBI |
| long-chain fatty acyl-adenylate | ChEBI |