EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35O7.Na |
| Net Charge | 0 |
| Average Mass | 446.516 |
| Monoisotopic Mass | 446.22805 |
| SMILES | [H][C@@]12C(=C[C@@H](O)C[C@@H]1OC(=O)[C@@H](C)CC)C=C[C@H](C)[C@@H]2CC[C@@H](O)C[C@@H](O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C23H36O7.Na/c1-4-13(2)23(29)30-20-11-17(25)9-15-6-5-14(3)19(22(15)20)8-7-16(24)10-18(26)12-21(27)28;/h5-6,9,13-14,16-20,22,24-26H,4,7-8,10-12H2,1-3H3,(H,27,28);/q;+1/p-1/t13-,14-,16+,17+,18+,19-,20-,22-;/m0./s1 |
| InChIKey | VWBQYTRBTXKKOG-IYNICTALSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pravastatin sodium (CHEBI:8361) has part pravastatin(1−) (CHEBI:63660) |
| pravastatin sodium (CHEBI:8361) has role anticholesteremic drug (CHEBI:35821) |
| pravastatin sodium (CHEBI:8361) is a organic sodium salt (CHEBI:38700) |
| pravastatin sodium (CHEBI:8361) is a statin (semi-synthetic) (CHEBI:87633) |
| IUPAC Name |
|---|
| sodium (3R,5R)-3,5-dihydroxy-7-[(1S,2S,6S,8S,8aR)-6-hydroxy-2-methyl-8-{[(2S)-2-methylbutanoyl]oxy}-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]heptanoate |
| Manual Xrefs | Databases |
|---|---|
| D00893 | KEGG DRUG |
| DB00175 | DrugBank |
| HMDB0005022 | HMDB |
| Parvaststin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4224939 | Reaxys |
| CAS:81131-70-6 | KEGG DRUG |
| CAS:81131-70-6 | ChemIDplus |
| Citations |
|---|