EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12F3NO4 |
| Net Charge | 0 |
| Average Mass | 327.258 |
| Monoisotopic Mass | 327.07184 |
| SMILES | C[C@@H](Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C15H12F3NO4/c1-9(14(20)21)22-11-3-5-12(6-4-11)23-13-7-2-10(8-19-13)15(16,17)18/h2-9H,1H3,(H,20,21)/t9-/m1/s1 |
| InChIKey | YUVKUEAFAVKILW-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluazifop-P (CHEBI:83599) has role agrochemical (CHEBI:33286) |
| fluazifop-P (CHEBI:83599) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| fluazifop-P (CHEBI:83599) has role phenoxy herbicide (CHEBI:60575) |
| fluazifop-P (CHEBI:83599) is a 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid (CHEBI:83598) |
| fluazifop-P (CHEBI:83599) is enantiomer of (S)-fluazifop (CHEBI:83600) |
| Incoming Relation(s) |
| fluazifop-P-butyl (CHEBI:132964) has functional parent fluazifop-P (CHEBI:83599) |
| fluazifop (CHEBI:81805) has part fluazifop-P (CHEBI:83599) |
| (S)-fluazifop (CHEBI:83600) is enantiomer of fluazifop-P (CHEBI:83599) |
| IUPAC Name |
|---|
| (2R)-2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid |
| Synonyms | Source |
|---|---|
| (R)-(+)-fluazifop | ChEBI |
| (R)-fluazifop | ChEBI |
| (+)-(R)-fluazifop | ChEBI |
| (+)-fluazifop | ChEBI |
| (R)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid | Alan Wood's Pesticides |
| (2R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| fluazifop-p | Alan Wood's Pesticides |
| 813 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8852807 | Reaxys |
| CAS:83066-88-0 | ChemIDplus |
| CAS:83066-88-0 | Alan Wood's Pesticides |
| Citations |
|---|