EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20F3NO4 |
| Net Charge | 0 |
| Average Mass | 383.366 |
| Monoisotopic Mass | 383.13444 |
| SMILES | CCCCOC(=O)[C@@H](C)Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C19H20F3NO4/c1-3-4-11-25-18(24)13(2)26-15-6-8-16(9-7-15)27-17-10-5-14(12-23-17)19(20,21)22/h5-10,12-13H,3-4,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | VAIZTNZGPYBOGF-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluazifop-P-butyl (CHEBI:132964) has functional parent fluazifop-P (CHEBI:83599) |
| fluazifop-P-butyl (CHEBI:132964) has role agrochemical (CHEBI:33286) |
| fluazifop-P-butyl (CHEBI:132964) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| fluazifop-P-butyl (CHEBI:132964) has role herbicide (CHEBI:24527) |
| fluazifop-P-butyl (CHEBI:132964) is a butyl 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate (CHEBI:132963) |
| fluazifop-P-butyl (CHEBI:132964) is enantiomer of (S)-fluazifop-butyl (CHEBI:132965) |
| Incoming Relation(s) |
| fluazifop-butyl (CHEBI:5097) has part fluazifop-P-butyl (CHEBI:132964) |
| (S)-fluazifop-butyl (CHEBI:132965) is enantiomer of fluazifop-P-butyl (CHEBI:132964) |
| IUPAC Name |
|---|
| butyl (2R)-2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| Synonyms | Source |
|---|---|
| butyl (2R)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate | Alan Wood's Pesticides |
| butyl (R)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionate | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Fusilade II | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| fluazifop-p-butyl | Alan Wood's Pesticides |
| 324 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8346184 | Reaxys |
| CAS:79241-46-6 | Alan Wood's Pesticides |
| CAS:79241-46-6 | ChemIDplus |
| Citations |
|---|