EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N2O |
| Net Charge | +1 |
| Average Mass | 137.162 |
| Monoisotopic Mass | 137.07094 |
| SMILES | C[n+]1ccccc1/C=N/O |
| InChI | InChI=1S/C7H8N2O/c1-9-5-3-2-4-7(9)6-8-10/h2-6H,1H3/p+1 |
| InChIKey | JBKPUQTUERUYQE-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| Applications: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. antidote to sarin poisoning A role borne by a molecule that acts to counteract or neutralise the nerve agent sarin. antidote to organophosphate poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of organophosphates or acetylcholinesterase inhibitors (nerve agents). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pralidoxime (CHEBI:8354) has role antidote to organophosphate poisoning (CHEBI:90753) |
| pralidoxime (CHEBI:8354) has role antidote to sarin poisoning (CHEBI:136860) |
| pralidoxime (CHEBI:8354) has role cholinergic drug (CHEBI:38323) |
| pralidoxime (CHEBI:8354) has role cholinesterase reactivator (CHEBI:50241) |
| pralidoxime (CHEBI:8354) is a pyridinium ion (CHEBI:50334) |
| Incoming Relation(s) |
| pralidoxime chloride (CHEBI:8355) has part pralidoxime (CHEBI:8354) |
| pralidoxime iodide (CHEBI:32038) has part pralidoxime (CHEBI:8354) |
| pralidoxime mesylate (CHEBI:50240) has part pralidoxime (CHEBI:8354) |
| IUPAC Name |
|---|
| 2-[(E)-(hydroxyimino)methyl]-1-methylpyridinium |
| INN | Source |
|---|---|
| pralidoxime | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-PAM | ChemIDplus |
| Pralidoxime | KEGG COMPOUND |
| Pralidoximum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2231 | DrugCentral |
| C07400 | KEGG COMPOUND |
| DB00733 | DrugBank |
| HMDB0014871 | HMDB |
| LSM-5708 | LINCS |
| Pralidoxime | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1526531 | Reaxys |
| CAS:6735-59-7 | KEGG COMPOUND |
| CAS:6735-59-7 | ChemIDplus |
| Citations |
|---|