EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N2O.CH3O3S |
| Net Charge | 0 |
| Average Mass | 232.261 |
| Monoisotopic Mass | 232.05178 |
| SMILES | CS(=O)(=O)[O-].C[n+]1ccccc1/C=N/O |
| InChI | InChI=1S/C7H8N2O.CH4O3S/c1-9-5-3-2-4-7(9)6-8-10;1-5(2,3)4/h2-6H,1H3;1H3,(H,2,3,4) |
| InChIKey | WWZYJJGFUIAWNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| Application: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pralidoxime mesylate (CHEBI:50240) has part pralidoxime (CHEBI:8354) |
| pralidoxime mesylate (CHEBI:50240) has role cholinergic drug (CHEBI:38323) |
| pralidoxime mesylate (CHEBI:50240) has role cholinesterase reactivator (CHEBI:50241) |
| pralidoxime mesylate (CHEBI:50240) is a methanesulfonate salt (CHEBI:38037) |
| pralidoxime mesylate (CHEBI:50240) is a pyridinium salt (CHEBI:38188) |
| IUPAC Name |
|---|
| 2-[(E)-(hydroxyimino)methyl]-1-methylpyridinium methanesulfonate |