EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8355 - pralidoxime chloride
| Formula | C7H9N2O.Cl |
| Net Charge | 0 |
| Average Mass | 172.615 |
| Monoisotopic Mass | 172.04034 |
| SMILES | C[n+]1ccccc1/C=N/O.[Cl-] |
| InChI | InChI=1S/C7H8N2O.ClH/c1-9-5-3-2-4-7(9)6-8-10;/h2-6H,1H3;1H |
| InChIKey | HIGSLXSBYYMVKI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| Application: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pralidoxime chloride (CHEBI:8355) has part pralidoxime (CHEBI:8354) |
| pralidoxime chloride (CHEBI:8355) has role cholinergic drug (CHEBI:38323) |
| pralidoxime chloride (CHEBI:8355) has role cholinesterase reactivator (CHEBI:50241) |
| pralidoxime chloride (CHEBI:8355) is a organic chloride salt (CHEBI:36094) |
| pralidoxime chloride (CHEBI:8355) is a pyridinium salt (CHEBI:38188) |
| IUPAC Name |
|---|
| 2-[(E)-(hydroxyimino)methyl]-1-methylpyridinium chloride |
| Synonym | Source |
|---|---|
| Pralidoxine chloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Protopam | DrugBank |