EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N2O.Cl |
| Net Charge | 0 |
| Average Mass | 172.615 |
| Monoisotopic Mass | 172.04034 |
| SMILES | C[n+]1ccccc1/C=N/O.[Cl-] |
| InChI | InChI=1S/C7H8N2O.ClH/c1-9-5-3-2-4-7(9)6-8-10;/h2-6H,1H3;1H |
| InChIKey | HIGSLXSBYYMVKI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. cholinesterase reactivator A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| Applications: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pralidoxime chloride (CHEBI:8355) has part pralidoxime (CHEBI:8354) |
| pralidoxime chloride (CHEBI:8355) has role antidote (CHEBI:50247) |
| pralidoxime chloride (CHEBI:8355) has role cholinergic drug (CHEBI:38323) |
| pralidoxime chloride (CHEBI:8355) has role cholinesterase reactivator (CHEBI:50241) |
| pralidoxime chloride (CHEBI:8355) is a organic chloride salt (CHEBI:36094) |
| pralidoxime chloride (CHEBI:8355) is a pyridinium salt (CHEBI:38188) |
| IUPAC Name |
|---|
| 2-[(E)-(hydroxyimino)methyl]-1-methylpyridinium chloride |
| Synonyms | Source |
|---|---|
| 2-PAM CHLORIDE | ChEMBL |
| NSC-164614 | ChEMBL |
| Pralidoxine chloride | ChemIDplus |
| Brand Names | Source |
|---|---|
| Contrathion | ChEMBL |
| Pralidoxime chloride (autoinjector) | ChEMBL |
| Pralidoxime chloride component of atnaa | ChEMBL |
| Pralidoxime chloride component of duodote | ChEMBL |
| Protopam | DrugBank |
| Protopam chloride | ChEMBL |
| Citations |
|---|