EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N5O6S2 |
| Net Charge | 0 |
| Average Mass | 387.399 |
| Monoisotopic Mass | 387.03073 |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C12H13N5O6S2/c1-6-13-10(16-12(14-6)23-3)15-11(19)17-25(20,21)7-4-5-24-8(7)9(18)22-2/h4-5H,1-3H3,(H2,13,14,15,16,17,19) |
| InChIKey | AHTPATJNIAFOLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thifensulfuron-methyl (CHEBI:83453) has functional parent thifensulfuron (CHEBI:132053) |
| thifensulfuron-methyl (CHEBI:83453) has role agrochemical (CHEBI:33286) |
| thifensulfuron-methyl (CHEBI:83453) has role environmental contaminant (CHEBI:78298) |
| thifensulfuron-methyl (CHEBI:83453) has role herbicide (CHEBI:24527) |
| thifensulfuron-methyl (CHEBI:83453) has role xenobiotic (CHEBI:35703) |
| thifensulfuron-methyl (CHEBI:83453) is a N-sulfonylurea (CHEBI:76983) |
| thifensulfuron-methyl (CHEBI:83453) is a 1,3,5-triazines (CHEBI:26588) |
| thifensulfuron-methyl (CHEBI:83453) is a methyl ester (CHEBI:25248) |
| thifensulfuron-methyl (CHEBI:83453) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| methyl 3-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}thiophene-2-carboxylate |
| Synonyms | Source |
|---|---|
| methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate | Alan Wood's Pesticides |
| thiameturon-methyl | Alan Wood's Pesticides |
| Thifensulfuron methyl | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 635 | PPDB |
| C10957 | KEGG COMPOUND |
| derivatives/thifensulfuron-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7448062 | Reaxys |
| CAS:79277-27-3 | KEGG COMPOUND |
| CAS:79277-27-3 | Alan Wood's Pesticides |
| CAS:79277-27-3 | ChemIDplus |
| Citations |
|---|