EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N5O6S2 |
| Net Charge | 0 |
| Average Mass | 373.372 |
| Monoisotopic Mass | 373.01508 |
| SMILES | COc1nc(C)nc(NC(=O)NS(=O)(=O)c2ccsc2C(=O)O)n1 |
| InChI | InChI=1S/C11H11N5O6S2/c1-5-12-9(15-11(13-5)22-2)14-10(19)16-24(20,21)6-3-4-23-7(6)8(17)18/h3-4H,1-2H3,(H,17,18)(H2,12,13,14,15,16,19) |
| InChIKey | LOQQVLXUKHKNIA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thifensulfuron (CHEBI:132053) has role agrochemical (CHEBI:33286) |
| thifensulfuron (CHEBI:132053) has role herbicide (CHEBI:24527) |
| thifensulfuron (CHEBI:132053) is a N-sulfonylurea (CHEBI:76983) |
| thifensulfuron (CHEBI:132053) is a 1,3,5-triazines (CHEBI:26588) |
| thifensulfuron (CHEBI:132053) is a thiophenecarboxylic acid (CHEBI:48436) |
| Incoming Relation(s) |
| thifensulfuron-methyl (CHEBI:83453) has functional parent thifensulfuron (CHEBI:132053) |
| IUPAC Name |
|---|
| 3-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}thiophene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylic acid | Alan Wood's Pesticides |
| thiameturon | Alan Wood's Pesticides |
| thifensulfuron acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 972 | PPDB |
| thifensulfuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:79277-67-1 | Alan Wood's Pesticides |
| CAS:79277-67-1 | ChemIDplus |
| Citations |
|---|