EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N2O5 |
| Net Charge | +1 |
| Average Mass | 387.456 |
| Monoisotopic Mass | 387.19145 |
| SMILES | COc1ccc(CC(C)(C)[NH2+]C[C@H](O)c2cc(O)cc3c2OCC(=O)N3)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/p+1/t18-/m0/s1 |
| InChIKey | COUYJEVMBVSIHV-SFHVURJKSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olodaterol(1+) (CHEBI:83312) is a ammonium ion derivative (CHEBI:35274) |
| olodaterol(1+) (CHEBI:83312) is a organic cation (CHEBI:25697) |
| olodaterol(1+) (CHEBI:83312) is conjugate acid of olodaterol (CHEBI:82700) |
| Incoming Relation(s) |
| olodaterol hydrochloride (CHEBI:83309) has part olodaterol(1+) (CHEBI:83312) |
| olodaterol (CHEBI:82700) is conjugate base of olodaterol(1+) (CHEBI:83312) |
| IUPAC Name |
|---|
| N-[(2R)-2-hydroxy-2-(6-hydroxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethyl]-1-(4-methoxyphenyl)-2-methylpropan-2-aminium |