EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O5.HCl |
| Net Charge | 0 |
| Average Mass | 422.909 |
| Monoisotopic Mass | 422.16085 |
| SMILES | COc1ccc(CC(C)(C)NC[C@H](O)c2cc(O)cc3c2OCC(=O)N3)cc1.Cl |
| InChI | InChI=1S/C21H26N2O5.ClH/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17;/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26);1H/t18-;/m0./s1 |
| InChIKey | KCEHVJZZIGJAAW-FERBBOLQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olodaterol hydrochloride (CHEBI:83309) has part olodaterol(1+) (CHEBI:83312) |
| olodaterol hydrochloride (CHEBI:83309) has role bronchodilator agent (CHEBI:35523) |
| olodaterol hydrochloride (CHEBI:83309) has role β-adrenergic agonist (CHEBI:35522) |
| olodaterol hydrochloride (CHEBI:83309) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| Stiolto Respimat (CHEBI:90958) has part olodaterol hydrochloride (CHEBI:83309) |
| IUPAC Names |
|---|
| 6-hydroxy-8-[(1R)-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl]-2H-1,4-benzoxazin-3(4H)-one hydrochloride |
| N-[(2R)-2-hydroxy-2-(6-hydroxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-8-yl)ethyl]-1-(4-methoxyphenyl)-2-methylpropan-2-aminium chloride |
| Brand Name | Source |
|---|---|
| STRIVERDI RESPIMAT | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10020 | KEGG DRUG |
| Olodaterol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12431872 | Reaxys |
| CAS:869477-96-3 | ChemIDplus |